For research use only
| Product Infomation | |
| Product Name | Elacytarabine |
|---|---|
| CAS No. | 188181-42-2 |
| Molecular Weight | 507.66
|
| Formula | C₂₇H₄₅N₃O₆ |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(OC[C@H]([C@@H](O)[C@@H]1O)O[C@H]1N2C(N=C(N)C=C2)=O)=O |
| Stock status | Instock |
Online consultation: 
Product description:
| Description | Elacytarabine (CP 4055) is a lipid-conjugated derivative of the nucleoside analog cytarabine. Elacytarabine (CP 4055) is an antineoplastic drug with cytotoxicity in solid tumors. | |
| Powder | -20°C | 3 years |
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month | |
Peferences:
